C19H23ClFNO2 — CID 11631684
1-[(4-fluorophenyl)methyl]-3-(3-methoxyphenyl)piperidin-3-ol;hydrochloride (PubChem CID 11631684) has the molecular formula C19H23ClFNO2 and a molecular weight of 351.85 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(3-methoxyphenyl)piperidin-3-ol;hydrochloride.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(3-methoxyphenyl)piperidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 11631684 |
| Molecular Formula | C19H23ClFNO2 |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(3-methoxyphenyl)piperidin-3-ol;hydrochloride |
| SMILES | COc1cccc(C2(O)CCCN(Cc3ccc(F)cc3)C2)c1.Cl |
| InChI | InChI=1S/C19H22FNO2.ClH/c1-23-18-5-2-4-16(12-18)19(22)10-3-11-21(14-19)13-15-6-8-17(20)9-7-15;/h2,4-9,12,22H,3,10-11,13-14H2,1H3;1H |
| InChIKey | FDIJJSLDVWBBAL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |