C18H26N4O2 — CID 129486038
(3R)-1-[(3-methoxyphenyl)methyl]-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol (PubChem CID 129486038) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3R)-1-[(3-methoxyphenyl)methyl]-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol.
| Compound Name | (3R)-1-[(3-methoxyphenyl)methyl]-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 129486038 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (3R)-1-[(3-methoxyphenyl)methyl]-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol |
| SMILES | COc1cccc(CN2CCC[C@](O)(c3cn(C(C)C)nn3)C2)c1 |
| InChI | InChI=1S/C18H26N4O2/c1-14(2)22-12-17(19-20-22)18(23)8-5-9-21(13-18)11-15-6-4-7-16(10-15)24-3/h4,6-7,10,12,14,23H,5,8-9,11,13H2,1-3H3/t18-/m1/s1 |
| InChIKey | SIGQFWVWJDNCST-GOSISDBHSA-N |
| XLogP | 2.35 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |