C18H30N6O — CID 128979150
1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol (PubChem CID 128979150) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol.
| Compound Name | 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 128979150 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol |
| SMILES | CC(C)Cn1cc(CN2CCCC(O)(c3cn(C(C)C)nn3)C2)cn1 |
| InChI | InChI=1S/C18H30N6O/c1-14(2)9-23-11-16(8-19-23)10-22-7-5-6-18(25,13-22)17-12-24(15(3)4)21-20-17/h8,11-12,14-15,25H,5-7,9-10,13H2,1-4H3 |
| InChIKey | NHUDFPKOMHHOGW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |