C24H27ClN2O4 — CID 10160604
ethyl 5-chloro-3-[[3-hydroxy-3-(3-methoxyphenyl)piperidin-1-yl]methyl]-1H-indole-2-carboxylate (PubChem CID 10160604) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is ethyl 5-chloro-3-[[3-hydroxy-3-(3-methoxyphenyl)piperidin-1-yl]methyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-chloro-3-[[3-hydroxy-3-(3-methoxyphenyl)piperidin-1-yl]methyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 10160604 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | ethyl 5-chloro-3-[[3-hydroxy-3-(3-methoxyphenyl)piperidin-1-yl]methyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(Cl)cc2c1CN1CCCC(O)(c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C24H27ClN2O4/c1-3-31-23(28)22-20(19-13-17(25)8-9-21(19)26-22)14-27-11-5-10-24(29,15-27)16-6-4-7-18(12-16)30-2/h4,6-9,12-13,26,29H,3,5,10-11,14-15H2,1-2H3 |
| InChIKey | CVNFXFMEZRDAEA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|