C27H34N2O4 — CID 10161103
ethyl 3-[[[2-hydroxy-2-(3-methoxyphenyl)cyclohexyl]methylamino]methyl]-5-methyl-1H-indole-2-carboxylate (PubChem CID 10161103) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is ethyl 3-[[[2-hydroxy-2-(3-methoxyphenyl)cyclohexyl]methylamino]methyl]-5-methyl-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[[[2-hydroxy-2-(3-methoxyphenyl)cyclohexyl]methylamino]methyl]-5-methyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 10161103 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | ethyl 3-[[[2-hydroxy-2-(3-methoxyphenyl)cyclohexyl]methylamino]methyl]-5-methyl-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(C)cc2c1CNCC1CCCCC1(O)c1cccc(OC)c1 |
| InChI | InChI=1S/C27H34N2O4/c1-4-33-26(30)25-23(22-14-18(2)11-12-24(22)29-25)17-28-16-20-8-5-6-13-27(20,31)19-9-7-10-21(15-19)32-3/h7,9-12,14-15,20,28-29,31H,4-6,8,13,16-17H2,1-3H3 |
| InChIKey | SJDNCRBQBCEQOB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|