C17H28INO2 — CID 163331114
[2-hydroxy-2-(3-methoxyphenyl)cyclohexyl]methyl-trimethylazanium iodide (PubChem CID 163331114) has the molecular formula C17H28INO2 and a molecular weight of 405.32 g/mol. Its IUPAC name is [2-hydroxy-2-(3-methoxyphenyl)cyclohexyl]methyl-trimethylazanium iodide.
| Compound Name | [2-hydroxy-2-(3-methoxyphenyl)cyclohexyl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 163331114 |
| Molecular Formula | C17H28INO2 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [2-hydroxy-2-(3-methoxyphenyl)cyclohexyl]methyl-trimethylazanium iodide |
| SMILES | COc1cccc(C2(O)CCCCC2C[N+](C)(C)C)c1.[I-] |
| InChI | InChI=1S/C17H28NO2.HI/c1-18(2,3)13-15-8-5-6-11-17(15,19)14-9-7-10-16(12-14)20-4;/h7,9-10,12,15,19H,5-6,8,11,13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FTIQNRNYWRGQRV-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|