C28H34BrNO2 — CID 155890264
(1R)-2-[(dibenzylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrobromide (PubChem CID 155890264) has the molecular formula C28H34BrNO2 and a molecular weight of 496.49 g/mol. Its IUPAC name is (1R)-2-[(dibenzylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrobromide.
| Compound Name | (1R)-2-[(dibenzylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrobromide |
|---|---|
| PubChem CID | 155890264 |
| Molecular Formula | C28H34BrNO2 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (1R)-2-[(dibenzylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrobromide |
| SMILES | Br.COc1cccc([C@@]2(O)CCCCC2CN(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C28H33NO2.BrH/c1-31-27-17-10-16-25(19-27)28(30)18-9-8-15-26(28)22-29(20-23-11-4-2-5-12-23)21-24-13-6-3-7-14-24;/h2-7,10-14,16-17,19,26,30H,8-9,15,18,20-22H2,1H3;1H/t26?,28-;/m0./s1 |
| InChIKey | VYMNGNRECPJKRO-PGEBJSFNSA-N |
| XLogP | 6.35 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |