C16H25ClINO — CID 9654
[2-(4-chlorophenyl)-2-hydroxycyclohexyl]methyl-trimethylazanium iodide (PubChem CID 9654) has the molecular formula C16H25ClINO and a molecular weight of 409.74 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-hydroxycyclohexyl]methyl-trimethylazanium iodide.
| Compound Name | [2-(4-chlorophenyl)-2-hydroxycyclohexyl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 9654 |
| Molecular Formula | C16H25ClINO |
| Molecular Weight | 409.74 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [2-(4-chlorophenyl)-2-hydroxycyclohexyl]methyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CC1CCCCC1(O)c1ccc(Cl)cc1.[I-] |
| InChI | InChI=1S/C16H25ClNO.HI/c1-18(2,3)12-14-6-4-5-11-16(14,19)13-7-9-15(17)10-8-13;/h7-10,14,19H,4-6,11-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LXFLBGSSFRFRGI-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.74 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|