C15H20O3 — CID 100982423
methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate (PubChem CID 100982423) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate.
| Compound Name | methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate |
|---|---|
| PubChem CID | 100982423 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate |
| SMILES | COC(=O)C[C@@H]1CCCC[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-18-14(16)11-13-9-5-6-10-15(13,17)12-7-3-2-4-8-12/h2-4,7-8,13,17H,5-6,9-11H2,1H3/t13-,15-/m0/s1 |
| InChIKey | VSBZAWLRLDHPJJ-ZFWWWQNUSA-N |
| XLogP | 2.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |