methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate

C15H20O3 — CID 100982423

IUPACmethyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate
SMILESCOC(=O)C[C@@H]1CCCC[C@]1(O)c1ccccc1
InChIInChI=1S/C15H20O3/c1-18-14(16)11-13-9-5-6-10-15(13,17)12-7-3-2-4-8-12/h2-4,7-8,13,17H,5-6,9-11H2,1H3/t13-,15-/m0/s1
InChIKeyVSBZAWLRLDHPJJ-ZFWWWQNUSA-N
MW248.32 g/mol
LogP2.63
Rot. Bonds3

About methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate

methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate (PubChem CID 100982423) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate.

Molecular Properties

Compound Namemethyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate
PubChem CID100982423
Molecular FormulaC15H20O3
Molecular Weight248.32 g/mol
Exact Mass248.14
IUPAC Namemethyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate
SMILESCOC(=O)C[C@@H]1CCCC[C@]1(O)c1ccccc1
InChIInChI=1S/C15H20O3/c1-18-14(16)11-13-9-5-6-10-15(13,17)12-7-3-2-4-8-12/h2-4,7-8,13,17H,5-6,9-11H2,1H3/t13-,15-/m0/s1
InChIKeyVSBZAWLRLDHPJJ-ZFWWWQNUSA-N
XLogP2.63
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.32
LogP ≤ 52.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate?
The IUPAC name of methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate (CID 100982423) is methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate.
What is the SMILES notation for methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate?
The canonical SMILES for methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate is COC(=O)C[C@@H]1CCCC[C@]1(O)c1ccccc1.
What is the InChIKey of methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate?
The InChIKey is VSBZAWLRLDHPJJ-ZFWWWQNUSA-N. The full InChI is InChI=1S/C15H20O3/c1-18-14(16)11-13-9-5-6-10-15(13,17)12-7-3-2-4-8-12/h2-4,7-8,13,17H,5-6,9-11H2,1H3/t13-,15-/m0/s1.
What are the key properties of methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate?
methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate has a molecular weight of 248.32 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1S,2R)-2-hydroxy-2-phenylcyclohexyl]acetate is sourced from PubChem (CID 100982423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).