C16H22N2O2S — CID 10425279
methyl 2-[(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl]acetate (PubChem CID 10425279) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is methyl 2-[(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl]acetate.
| Compound Name | methyl 2-[(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl]acetate |
|---|---|
| PubChem CID | 10425279 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | methyl 2-[(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl]acetate |
| SMILES | CNC(=S)[C@@]1(c2cccnc2)CCCC[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C16H22N2O2S/c1-17-15(21)16(13-7-5-9-18-11-13)8-4-3-6-12(16)10-14(19)20-2/h5,7,9,11-12H,3-4,6,8,10H2,1-2H3,(H,17,21)/t12-,16+/m1/s1 |
| InChIKey | NRJGVYZHNXYJPY-WBMJQRKESA-N |
| XLogP | 2.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|