C17H24N2O2S — CID 19794564
[2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] butanoate (PubChem CID 19794564) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] butanoate.
| Compound Name | [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] butanoate |
|---|---|
| PubChem CID | 19794564 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] butanoate |
| SMILES | CCCC(=O)OC1CCCCC1(C(=S)NC)c1cccnc1 |
| InChI | InChI=1S/C17H24N2O2S/c1-3-7-15(20)21-14-9-4-5-10-17(14,16(22)18-2)13-8-6-11-19-12-13/h6,8,11-12,14H,3-5,7,9-10H2,1-2H3,(H,18,22) |
| InChIKey | RUAIBBGENHFMAN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|