About [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate
[(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate (PubChem CID 22847506) has the molecular formula C21H24N2O3S
and a molecular weight of 384.50 g/mol. Its IUPAC name is [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate.
Molecular Properties
| Compound Name | [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate |
| PubChem CID | 22847506 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate |
| SMILES | CNC(=S)[C@]1(c2cccnc2)CCCC[C@H]1OC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H24N2O3S/c1-22-20(27)21(16-8-6-12-23-14-16)11-4-3-10-18(21)26-19(24)15-7-5-9-17(13-15)25-2/h5-9,12-14,18H,3-4,10-11H2,1-2H3,(H,22,27)/t18-,21+/m1/s1 |
| InChIKey | BQFJIENOPFNDEK-NQIIRXRSSA-N |
| XLogP | 3.67 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate?
The IUPAC name of [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate (CID 22847506) is [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate.
What is the SMILES notation for [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate?
The canonical SMILES for [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate is CNC(=S)[C@]1(c2cccnc2)CCCC[C@H]1OC(=O)c1cccc(OC)c1.
What is the InChIKey of [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate?
The InChIKey is BQFJIENOPFNDEK-NQIIRXRSSA-N. The full InChI is InChI=1S/C21H24N2O3S/c1-22-20(27)21(16-8-6-12-23-14-16)11-4-3-10-18(21)26-19(24)15-7-5-9-17(13-15)25-2/h5-9,12-14,18H,3-4,10-11H2,1-2H3,(H,22,27)/t18-,21+/m1/s1.
What are the key properties of [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate?
[(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate has a molecular weight of 384.50 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 3-methoxybenzoate is sourced from PubChem (CID 22847506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).