C18H29N3O2S2 — CID 23175721
N-methyl-2-[2-(propylsulfonylamino)ethyl]-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 23175721) has the molecular formula C18H29N3O2S2 and a molecular weight of 383.58 g/mol. Its IUPAC name is N-methyl-2-[2-(propylsulfonylamino)ethyl]-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | N-methyl-2-[2-(propylsulfonylamino)ethyl]-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 23175721 |
| Molecular Formula | C18H29N3O2S2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-methyl-2-[2-(propylsulfonylamino)ethyl]-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CCCS(=O)(=O)NCCC1CCCCC1(C(=S)NC)c1cccnc1 |
| InChI | InChI=1S/C18H29N3O2S2/c1-3-13-25(22,23)21-12-9-15-7-4-5-10-18(15,17(24)19-2)16-8-6-11-20-14-16/h6,8,11,14-15,21H,3-5,7,9-10,12-13H2,1-2H3,(H,19,24) |
| InChIKey | IPXCFGGOZQKUFJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|