C23H31N5O2S2 — CID 10322636
trans-(1S,2R)-2-[2-[[N-(benzenesulfonyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 10322636) has the molecular formula C23H31N5O2S2 and a molecular weight of 473.67 g/mol. Its IUPAC name is trans-(1S,2R)-2-[2-[[N-(benzenesulfonyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | trans-(1S,2R)-2-[2-[[N-(benzenesulfonyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 10322636 |
| Molecular Formula | C23H31N5O2S2 |
| Molecular Weight | 473.67 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | trans-(1S,2R)-2-[2-[[N-(benzenesulfonyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | C/N=C(/NCC[C@H]1CCCC[C@@]1(C(=S)NC)c1cccnc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H31N5O2S2/c1-24-21(31)23(19-10-8-15-26-17-19)14-7-6-9-18(23)13-16-27-22(25-2)28-32(29,30)20-11-4-3-5-12-20/h3-5,8,10-12,15,17-18H,6-7,9,13-14,16H2,1-2H3,(H,24,31)(H2,25,27,28)/t18-,23+/m1/s1 |
| InChIKey | NCDJDTIMAUKYBZ-JPYJTQIMSA-N |
| XLogP | 3.00 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|