C22H29N3O2S2 — CID 23175715
2-[2-(benzenesulfonamido)ethyl]-N-ethyl-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 23175715) has the molecular formula C22H29N3O2S2 and a molecular weight of 431.63 g/mol. Its IUPAC name is 2-[2-(benzenesulfonamido)ethyl]-N-ethyl-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | 2-[2-(benzenesulfonamido)ethyl]-N-ethyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 23175715 |
| Molecular Formula | C22H29N3O2S2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[2-(benzenesulfonamido)ethyl]-N-ethyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CCNC(=S)C1(c2cccnc2)CCCCC1CCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O2S2/c1-2-24-21(28)22(19-10-8-15-23-17-19)14-7-6-9-18(22)13-16-25-29(26,27)20-11-4-3-5-12-20/h3-5,8,10-12,15,17-18,25H,2,6-7,9,13-14,16H2,1H3,(H,24,28) |
| InChIKey | GUWPMALGUHGCGE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|