C19H27N3O3S — CID 22847522
[(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 4-(dimethylamino)-4-oxobutanoate (PubChem CID 22847522) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 4-(dimethylamino)-4-oxobutanoate.
| Compound Name | [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 4-(dimethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 22847522 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 4-(dimethylamino)-4-oxobutanoate |
| SMILES | CNC(=S)[C@]1(c2cccnc2)CCCC[C@H]1OC(=O)CCC(=O)N(C)C |
| InChI | InChI=1S/C19H27N3O3S/c1-20-18(26)19(14-7-6-12-21-13-14)11-5-4-8-15(19)25-17(24)10-9-16(23)22(2)3/h6-7,12-13,15H,4-5,8-11H2,1-3H3,(H,20,26)/t15-,19+/m1/s1 |
| InChIKey | XNTDXAWTUOCWSH-BEFAXECRSA-N |
| XLogP | 2.22 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|