C19H27N3O3S — CID 54105003
[(1R,2S)-6-(dimethylcarbamoyl)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] propanoate (PubChem CID 54105003) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is [(1R,2S)-6-(dimethylcarbamoyl)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] propanoate.
| Compound Name | [(1R,2S)-6-(dimethylcarbamoyl)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] propanoate |
|---|---|
| PubChem CID | 54105003 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | [(1R,2S)-6-(dimethylcarbamoyl)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] propanoate |
| SMILES | CCC(=O)O[C@@H]1C(C(=O)N(C)C)CCC[C@]1(C(=S)NC)c1cccnc1 |
| InChI | InChI=1S/C19H27N3O3S/c1-5-15(23)25-16-14(17(24)22(3)4)9-6-10-19(16,18(26)20-2)13-8-7-11-21-12-13/h7-8,11-12,14,16H,5-6,9-10H2,1-4H3,(H,20,26)/t14?,16-,19+/m1/s1 |
| InChIKey | NDDBQUYBOBCFLZ-NBMIWUGMSA-N |
| XLogP | 2.08 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|