C22H34N4O4S — CID 22847558
[(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 4-(4-methylpiperazin-1-yl)-4-oxobutanoate;hydrate (PubChem CID 22847558) has the molecular formula C22H34N4O4S and a molecular weight of 450.61 g/mol. Its IUPAC name is [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 4-(4-methylpiperazin-1-yl)-4-oxobutanoate;hydrate.
| Compound Name | [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 4-(4-methylpiperazin-1-yl)-4-oxobutanoate;hydrate |
|---|---|
| PubChem CID | 22847558 |
| Molecular Formula | C22H34N4O4S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1R,2S)-2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 4-(4-methylpiperazin-1-yl)-4-oxobutanoate;hydrate |
| SMILES | CNC(=S)[C@]1(c2cccnc2)CCCC[C@H]1OC(=O)CCC(=O)N1CCN(C)CC1.O |
| InChI | InChI=1S/C22H32N4O3S.H2O/c1-23-21(30)22(17-6-5-11-24-16-17)10-4-3-7-18(22)29-20(28)9-8-19(27)26-14-12-25(2)13-15-26;/h5-6,11,16,18H,3-4,7-10,12-15H2,1-2H3,(H,23,30);1H2/t18-,22+;/m1./s1 |
| InChIKey | JIDXKCAQQRRDRE-MYXGOWFTSA-N |
| XLogP | 1.08 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|