C19H25N3O2S3 — CID 23175733
N-methyl-1-pyridin-3-yl-2-[2-(thiophen-2-ylsulfonylamino)ethyl]cyclohexane-1-carbothioamide (PubChem CID 23175733) has the molecular formula C19H25N3O2S3 and a molecular weight of 423.63 g/mol. Its IUPAC name is N-methyl-1-pyridin-3-yl-2-[2-(thiophen-2-ylsulfonylamino)ethyl]cyclohexane-1-carbothioamide.
| Compound Name | N-methyl-1-pyridin-3-yl-2-[2-(thiophen-2-ylsulfonylamino)ethyl]cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 23175733 |
| Molecular Formula | C19H25N3O2S3 |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-methyl-1-pyridin-3-yl-2-[2-(thiophen-2-ylsulfonylamino)ethyl]cyclohexane-1-carbothioamide |
| SMILES | CNC(=S)C1(c2cccnc2)CCCCC1CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H25N3O2S3/c1-20-18(25)19(16-7-4-11-21-14-16)10-3-2-6-15(19)9-12-22-27(23,24)17-8-5-13-26-17/h4-5,7-8,11,13-15,22H,2-3,6,9-10,12H2,1H3,(H,20,25) |
| InChIKey | FPDCZUYVKJQVAR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|