C15H22N2OS — CID 10084971
trans-(1S,2R)-2-(2-hydroxyethyl)-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 10084971) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is trans-(1S,2R)-2-(2-hydroxyethyl)-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | trans-(1S,2R)-2-(2-hydroxyethyl)-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 10084971 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | trans-(1S,2R)-2-(2-hydroxyethyl)-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CNC(=S)[C@@]1(c2cccnc2)CCCC[C@@H]1CCO |
| InChI | InChI=1S/C15H22N2OS/c1-16-14(19)15(13-6-4-9-17-11-13)8-3-2-5-12(15)7-10-18/h4,6,9,11-12,18H,2-3,5,7-8,10H2,1H3,(H,16,19)/t12-,15+/m1/s1 |
| InChIKey | IBRPNRNXAXLFDL-DOMZBBRYSA-N |
| XLogP | 2.44 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|