C17H27N3O2 — CID 140540614
2-[4-(dimethylamino)-4-pyridin-3-ylcyclohexyl]ethyl N-methylcarbamate (PubChem CID 140540614) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-4-pyridin-3-ylcyclohexyl]ethyl N-methylcarbamate.
| Compound Name | 2-[4-(dimethylamino)-4-pyridin-3-ylcyclohexyl]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 140540614 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 2-[4-(dimethylamino)-4-pyridin-3-ylcyclohexyl]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCC1CCC(c2cccnc2)(N(C)C)CC1 |
| InChI | InChI=1S/C17H27N3O2/c1-18-16(21)22-12-8-14-6-9-17(10-7-14,20(2)3)15-5-4-11-19-13-15/h4-5,11,13-14H,6-10,12H2,1-3H3,(H,18,21) |
| InChIKey | QOUNSCNOQHBCNQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |