C16H26BN3 — CID 89140707
CID 89140707 (PubChem CID 89140707) has the molecular formula C16H26BN3 and a molecular weight of 271.22 g/mol.
| Compound Name | CID 89140707 |
|---|---|
| PubChem CID | 89140707 |
| Molecular Formula | C16H26BN3 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.22 |
| IUPAC Name | — |
| SMILES | [B]N(C)CCC1CCC(c2cccnc2)(N(C)C)CC1 |
| InChI | InChI=1S/C16H26BN3/c1-19(2)16(15-5-4-11-18-13-15)9-6-14(7-10-16)8-12-20(3)17/h4-5,11,13-14H,6-10,12H2,1-3H3 |
| InChIKey | OBGZFWNHDHKDTC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|