About CID 89140707
CID 89140707 (PubChem CID 89140707) has the molecular formula C16H26BN3
and a molecular weight of 271.22 g/mol.
Molecular Properties
| Compound Name | CID 89140707 |
| PubChem CID | 89140707 |
| Molecular Formula | C16H26BN3 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.22 |
| IUPAC Name | — |
| SMILES | [B]N(C)CCC1CCC(c2cccnc2)(N(C)C)CC1 |
| InChI | InChI=1S/C16H26BN3/c1-19(2)16(15-5-4-11-18-13-15)9-6-14(7-10-16)8-12-20(3)17/h4-5,11,13-14H,6-10,12H2,1-3H3 |
| InChIKey | OBGZFWNHDHKDTC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89140707 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89140707?
The IUPAC name of CID 89140707 (CID 89140707) is not available.
What is the SMILES notation for CID 89140707?
The canonical SMILES for CID 89140707 is [B]N(C)CCC1CCC(c2cccnc2)(N(C)C)CC1.
What is the InChIKey of CID 89140707?
The InChIKey is OBGZFWNHDHKDTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26BN3/c1-19(2)16(15-5-4-11-18-13-15)9-6-14(7-10-16)8-12-20(3)17/h4-5,11,13-14H,6-10,12H2,1-3H3.
What are the key properties of CID 89140707?
CID 89140707 has a molecular weight of 271.22 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89140707 is sourced from PubChem (CID 89140707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).