C10H13NO — CID 81358842
(2-methyl-2-pyridin-3-ylcyclopropyl)methanol (PubChem CID 81358842) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (2-methyl-2-pyridin-3-ylcyclopropyl)methanol.
| Compound Name | (2-methyl-2-pyridin-3-ylcyclopropyl)methanol |
|---|---|
| PubChem CID | 81358842 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2-methyl-2-pyridin-3-ylcyclopropyl)methanol |
| SMILES | CC1(c2cccnc2)CC1CO |
| InChI | InChI=1S/C10H13NO/c1-10(5-9(10)7-12)8-3-2-4-11-6-8/h2-4,6,9,12H,5,7H2,1H3 |
| InChIKey | ZBLRXZCFFBSDMN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |