C12H16ClN — CID 13486942
3-(1-chloro-2,2,3,3-tetramethylcyclopropyl)pyridine (PubChem CID 13486942) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 3-(1-chloro-2,2,3,3-tetramethylcyclopropyl)pyridine.
| Compound Name | 3-(1-chloro-2,2,3,3-tetramethylcyclopropyl)pyridine |
|---|---|
| PubChem CID | 13486942 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-(1-chloro-2,2,3,3-tetramethylcyclopropyl)pyridine |
| SMILES | CC1(C)C(C)(C)C1(Cl)c1cccnc1 |
| InChI | InChI=1S/C12H16ClN/c1-10(2)11(3,4)12(10,13)9-6-5-7-14-8-9/h5-8H,1-4H3 |
| InChIKey | XLDOGSNBYWKNBU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|