C13H17NO3 — CID 90089948
1-(2,2-dimethyl-5-pyridin-3-yl-1,3-dioxan-5-yl)ethanone (PubChem CID 90089948) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-(2,2-dimethyl-5-pyridin-3-yl-1,3-dioxan-5-yl)ethanone.
| Compound Name | 1-(2,2-dimethyl-5-pyridin-3-yl-1,3-dioxan-5-yl)ethanone |
|---|---|
| PubChem CID | 90089948 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-(2,2-dimethyl-5-pyridin-3-yl-1,3-dioxan-5-yl)ethanone |
| SMILES | CC(=O)C1(c2cccnc2)COC(C)(C)OC1 |
| InChI | InChI=1S/C13H17NO3/c1-10(15)13(11-5-4-6-14-7-11)8-16-12(2,3)17-9-13/h4-7H,8-9H2,1-3H3 |
| InChIKey | SHILAEJDLYOMMM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |