C17H17NO2 — CID 166293703
(3-methylphenyl) 1-pyridin-3-ylcyclobutane-1-carboxylate (PubChem CID 166293703) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (3-methylphenyl) 1-pyridin-3-ylcyclobutane-1-carboxylate.
| Compound Name | (3-methylphenyl) 1-pyridin-3-ylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 166293703 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3-methylphenyl) 1-pyridin-3-ylcyclobutane-1-carboxylate |
| SMILES | Cc1cccc(OC(=O)C2(c3cccnc3)CCC2)c1 |
| InChI | InChI=1S/C17H17NO2/c1-13-5-2-7-15(11-13)20-16(19)17(8-4-9-17)14-6-3-10-18-12-14/h2-3,5-7,10-12H,4,8-9H2,1H3 |
| InChIKey | ULFJNQWHFSFDKT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|