C17H15NO4 — CID 166293704
1,3-benzodioxol-5-yl 1-pyridin-3-ylcyclobutane-1-carboxylate (PubChem CID 166293704) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 1-pyridin-3-ylcyclobutane-1-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 1-pyridin-3-ylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 166293704 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1,3-benzodioxol-5-yl 1-pyridin-3-ylcyclobutane-1-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)C1(c2cccnc2)CCC1 |
| InChI | InChI=1S/C17H15NO4/c19-16(17(6-2-7-17)12-3-1-8-18-10-12)22-13-4-5-14-15(9-13)21-11-20-14/h1,3-5,8-10H,2,6-7,11H2 |
| InChIKey | HDYQMLBBCBXROE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|