C17H13ClO4 — CID 4827352
1,3-benzodioxol-5-yl 1-(4-chlorophenyl)cyclopropane-1-carboxylate (PubChem CID 4827352) has the molecular formula C17H13ClO4 and a molecular weight of 316.74 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 1-(4-chlorophenyl)cyclopropane-1-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 4827352 |
| Molecular Formula | C17H13ClO4 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1,3-benzodioxol-5-yl 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H13ClO4/c18-12-3-1-11(2-4-12)17(7-8-17)16(19)22-13-5-6-14-15(9-13)21-10-20-14/h1-6,9H,7-8,10H2 |
| InChIKey | NWOSYMNUKRNVJX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|