C11H10ClNO3 — CID 175169630
formamido 1-(4-chlorophenyl)cyclopropane-1-carboxylate (PubChem CID 175169630) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is formamido 1-(4-chlorophenyl)cyclopropane-1-carboxylate.
| Compound Name | formamido 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 175169630 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | formamido 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
| SMILES | O=CNOC(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C11H10ClNO3/c12-9-3-1-8(2-4-9)11(5-6-11)10(15)16-13-7-14/h1-4,7H,5-6H2,(H,13,14) |
| InChIKey | IZHBHHMFHFJYBU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|