C19H17ClO3 — CID 55312475
phenacyl 1-(4-chlorophenyl)cyclobutane-1-carboxylate (PubChem CID 55312475) has the molecular formula C19H17ClO3 and a molecular weight of 328.80 g/mol. Its IUPAC name is phenacyl 1-(4-chlorophenyl)cyclobutane-1-carboxylate.
| Compound Name | phenacyl 1-(4-chlorophenyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 55312475 |
| Molecular Formula | C19H17ClO3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | phenacyl 1-(4-chlorophenyl)cyclobutane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccc(Cl)cc2)CCC1)c1ccccc1 |
| InChI | InChI=1S/C19H17ClO3/c20-16-9-7-15(8-10-16)19(11-4-12-19)18(22)23-13-17(21)14-5-2-1-3-6-14/h1-3,5-10H,4,11-13H2 |
| InChIKey | GQNOVTSXBUTKOW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |