About [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate (PubChem CID 4239981) has the molecular formula C23H25ClO3
and a molecular weight of 384.90 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate |
| PubChem CID | 4239981 |
| Molecular Formula | C23H25ClO3 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)C2(c3ccc(Cl)cc3)CCCC2)cc1C |
| InChI | InChI=1S/C23H25ClO3/c1-15-12-17(3)20(13-16(15)2)21(25)14-27-22(26)23(10-4-5-11-23)18-6-8-19(24)9-7-18/h6-9,12-13H,4-5,10-11,14H2,1-3H3 |
| InChIKey | YXSMNDSECXVZCY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate?
The IUPAC name of [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate (CID 4239981) is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate.
What is the SMILES notation for [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate?
The canonical SMILES for [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate is Cc1cc(C)c(C(=O)COC(=O)C2(c3ccc(Cl)cc3)CCCC2)cc1C.
What is the InChIKey of [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate?
The InChIKey is YXSMNDSECXVZCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25ClO3/c1-15-12-17(3)20(13-16(15)2)21(25)14-27-22(26)23(10-4-5-11-23)18-6-8-19(24)9-7-18/h6-9,12-13H,4-5,10-11,14H2,1-3H3.
What are the key properties of [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate?
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate has a molecular weight of 384.90 g/mol, XLogP of 5.50, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate is sourced from PubChem (CID 4239981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).