C19H17ClO3 — CID 155946371
[2-(3-chlorophenyl)-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate (PubChem CID 155946371) has the molecular formula C19H17ClO3 and a molecular weight of 328.80 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate.
| Compound Name | [2-(3-chlorophenyl)-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 155946371 |
| Molecular Formula | C19H17ClO3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [2-(3-chlorophenyl)-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccccc2)CCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClO3/c20-16-9-4-6-14(12-16)17(21)13-23-18(22)19(10-5-11-19)15-7-2-1-3-8-15/h1-4,6-9,12H,5,10-11,13H2 |
| InChIKey | SOMQIUSSRDWZQI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |