About [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate
[2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate (PubChem CID 42983074) has the molecular formula C22H21Cl2NO4
and a molecular weight of 434.32 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate |
| PubChem CID | 42983074 |
| Molecular Formula | C22H21Cl2NO4 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate |
| SMILES | CC(=O)N1CCC(C(=O)OCC(=O)c2ccc(Cl)c(Cl)c2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H21Cl2NO4/c1-15(26)25-11-9-22(10-12-25,17-5-3-2-4-6-17)21(28)29-14-20(27)16-7-8-18(23)19(24)13-16/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | YJEFAQUQXWHVGZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate?
The IUPAC name of [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate (CID 42983074) is [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate.
What is the SMILES notation for [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate?
The canonical SMILES for [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate is CC(=O)N1CCC(C(=O)OCC(=O)c2ccc(Cl)c(Cl)c2)(c2ccccc2)CC1.
What is the InChIKey of [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate?
The InChIKey is YJEFAQUQXWHVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21Cl2NO4/c1-15(26)25-11-9-22(10-12-25,17-5-3-2-4-6-17)21(28)29-14-20(27)16-7-8-18(23)19(24)13-16/h2-8,13H,9-12,14H2,1H3.
What are the key properties of [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate?
[2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate has a molecular weight of 434.32 g/mol, XLogP of 4.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dichlorophenyl)-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate is sourced from PubChem (CID 42983074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).