C21H21Cl2NO3 — CID 8526973
(2,6-dichlorophenyl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate (PubChem CID 8526973) has the molecular formula C21H21Cl2NO3 and a molecular weight of 406.31 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate.
| Compound Name | (2,6-dichlorophenyl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 8526973 |
| Molecular Formula | C21H21Cl2NO3 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate |
| SMILES | CC(=O)N1CCC(C(=O)OCc2c(Cl)cccc2Cl)(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H21Cl2NO3/c1-15(25)24-12-10-21(11-13-24,16-6-3-2-4-7-16)20(26)27-14-17-18(22)8-5-9-19(17)23/h2-9H,10-14H2,1H3 |
| InChIKey | SKJVYROVOQSLAM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |