C23H25NO5 — CID 8527045
(3-methoxycarbonylphenyl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate (PubChem CID 8527045) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3-methoxycarbonylphenyl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate.
| Compound Name | (3-methoxycarbonylphenyl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 8527045 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (3-methoxycarbonylphenyl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate |
| SMILES | COC(=O)c1cccc(COC(=O)C2(c3ccccc3)CCN(C(C)=O)CC2)c1 |
| InChI | InChI=1S/C23H25NO5/c1-17(25)24-13-11-23(12-14-24,20-9-4-3-5-10-20)22(27)29-16-18-7-6-8-19(15-18)21(26)28-2/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | HCIKPPITJQTIQK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |