C25H25NO3 — CID 8526911
naphthalen-1-ylmethyl 1-acetyl-4-phenylpiperidine-4-carboxylate (PubChem CID 8526911) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 1-acetyl-4-phenylpiperidine-4-carboxylate.
| Compound Name | naphthalen-1-ylmethyl 1-acetyl-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 8526911 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | naphthalen-1-ylmethyl 1-acetyl-4-phenylpiperidine-4-carboxylate |
| SMILES | CC(=O)N1CCC(C(=O)OCc2cccc3ccccc23)(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H25NO3/c1-19(27)26-16-14-25(15-17-26,22-11-3-2-4-12-22)24(28)29-18-21-10-7-9-20-8-5-6-13-23(20)21/h2-13H,14-18H2,1H3 |
| InChIKey | TZDSTIJSKDQKQR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |