C20H15N3O2 — CID 68686087
3-(1,3-benzodioxol-5-yl)-3-pyridin-3-ylisoindol-1-amine (PubChem CID 68686087) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-pyridin-3-ylisoindol-1-amine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-pyridin-3-ylisoindol-1-amine |
|---|---|
| PubChem CID | 68686087 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-pyridin-3-ylisoindol-1-amine |
| SMILES | NC1=NC(c2cccnc2)(c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C20H15N3O2/c21-19-15-5-1-2-6-16(15)20(23-19,14-4-3-9-22-11-14)13-7-8-17-18(10-13)25-12-24-17/h1-11H,12H2,(H2,21,23) |
| InChIKey | YTIKTFVGJLETES-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |