C27H18F3N3O2 — CID 91206356
[4-[3-amino-1-(3-pyridin-3-ylphenyl)isoindol-1-yl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 91206356) has the molecular formula C27H18F3N3O2 and a molecular weight of 473.45 g/mol. Its IUPAC name is [4-[3-amino-1-(3-pyridin-3-ylphenyl)isoindol-1-yl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[3-amino-1-(3-pyridin-3-ylphenyl)isoindol-1-yl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91206356 |
| Molecular Formula | C27H18F3N3O2 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [4-[3-amino-1-(3-pyridin-3-ylphenyl)isoindol-1-yl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | NC1=NC(c2ccc(OC(=O)C(F)(F)F)cc2)(c2cccc(-c3cccnc3)c2)c2ccccc21 |
| InChI | InChI=1S/C27H18F3N3O2/c28-27(29,30)25(34)35-21-12-10-19(11-13-21)26(23-9-2-1-8-22(23)24(31)33-26)20-7-3-5-17(15-20)18-6-4-14-32-16-18/h1-16H,(H2,31,33) |
| InChIKey | YKAAWOYWNXHNFJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|