C26H20FN3O2S — CID 25154233
3-[3-(2-fluoro-3-pyridinyl)phenyl]-3-(4-methylsulfonylphenyl)isoindol-1-amine (PubChem CID 25154233) has the molecular formula C26H20FN3O2S and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-[3-(2-fluoro-3-pyridinyl)phenyl]-3-(4-methylsulfonylphenyl)isoindol-1-amine.
| Compound Name | 3-[3-(2-fluoro-3-pyridinyl)phenyl]-3-(4-methylsulfonylphenyl)isoindol-1-amine |
|---|---|
| PubChem CID | 25154233 |
| Molecular Formula | C26H20FN3O2S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 3-[3-(2-fluoro-3-pyridinyl)phenyl]-3-(4-methylsulfonylphenyl)isoindol-1-amine |
| SMILES | CS(=O)(=O)c1ccc(C2(c3cccc(-c4cccnc4F)c3)N=C(N)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H20FN3O2S/c1-33(31,32)20-13-11-18(12-14-20)26(23-10-3-2-8-22(23)25(28)30-26)19-7-4-6-17(16-19)21-9-5-15-29-24(21)27/h2-16H,1H3,(H2,28,30) |
| InChIKey | KBMSDSXMWGISPV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|