C20H16FN3 — CID 24874692
3-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylisoindol-1-amine (PubChem CID 24874692) has the molecular formula C20H16FN3 and a molecular weight of 317.37 g/mol. Its IUPAC name is 3-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylisoindol-1-amine.
| Compound Name | 3-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylisoindol-1-amine |
|---|---|
| PubChem CID | 24874692 |
| Molecular Formula | C20H16FN3 |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylisoindol-1-amine |
| SMILES | CC1(c2cccc(-c3cccnc3F)c2)N=C(N)c2ccccc21 |
| InChI | InChI=1S/C20H16FN3/c1-20(17-10-3-2-8-16(17)19(22)24-20)14-7-4-6-13(12-14)15-9-5-11-23-18(15)21/h2-12H,1H3,(H2,22,24) |
| InChIKey | MVEDCJMTZYLBDN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|