C25H21FN4O3 — CID 89138384
2-amino-5-[3,4-bis(oxiran-2-yl)phenyl]-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one (PubChem CID 89138384) has the molecular formula C25H21FN4O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-amino-5-[3,4-bis(oxiran-2-yl)phenyl]-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one.
| Compound Name | 2-amino-5-[3,4-bis(oxiran-2-yl)phenyl]-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one |
|---|---|
| PubChem CID | 89138384 |
| Molecular Formula | C25H21FN4O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-amino-5-[3,4-bis(oxiran-2-yl)phenyl]-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one |
| SMILES | CN1C(=O)C(c2cccc(-c3cccnc3F)c2)(c2ccc(C3CO3)c(C3CO3)c2)N=C1N |
| InChI | InChI=1S/C25H21FN4O3/c1-30-23(31)25(29-24(30)27,15-5-2-4-14(10-15)17-6-3-9-28-22(17)26)16-7-8-18(20-12-32-20)19(11-16)21-13-33-21/h2-11,20-21H,12-13H2,1H3,(H2,27,29) |
| InChIKey | SKNCOOHLEBORGF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|