C22H16F4N4O2 — CID 52944484
(5R)-2-amino-5-[4-(difluoromethoxy)phenyl]-5-[3-(2,5-difluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one (PubChem CID 52944484) has the molecular formula C22H16F4N4O2 and a molecular weight of 444.39 g/mol. Its IUPAC name is (5R)-2-amino-5-[4-(difluoromethoxy)phenyl]-5-[3-(2,5-difluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one.
| Compound Name | (5R)-2-amino-5-[4-(difluoromethoxy)phenyl]-5-[3-(2,5-difluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one |
|---|---|
| PubChem CID | 52944484 |
| Molecular Formula | C22H16F4N4O2 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (5R)-2-amino-5-[4-(difluoromethoxy)phenyl]-5-[3-(2,5-difluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one |
| SMILES | CN1C(=O)[C@@](c2ccc(OC(F)F)cc2)(c2cccc(-c3cc(F)cnc3F)c2)N=C1N |
| InChI | InChI=1S/C22H16F4N4O2/c1-30-19(31)22(29-21(30)27,13-5-7-16(8-6-13)32-20(25)26)14-4-2-3-12(9-14)17-10-15(23)11-28-18(17)24/h2-11,20H,1H3,(H2,27,29)/t22-/m1/s1 |
| InChIKey | MOACUBOFXBSLGO-JOCHJYFZSA-N |
| XLogP | 3.66 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|