C20H25ClF2N6O2 — CID 158457531
2-amino-5-[4-(difluoromethoxy)phenyl]-3-methyl-5-(3-methylphenyl)imidazol-4-one;2-methylguanidine;hydrochloride (PubChem CID 158457531) has the molecular formula C20H25ClF2N6O2 and a molecular weight of 454.91 g/mol. Its IUPAC name is 2-amino-5-[4-(difluoromethoxy)phenyl]-3-methyl-5-(3-methylphenyl)imidazol-4-one;2-methylguanidine;hydrochloride.
| Compound Name | 2-amino-5-[4-(difluoromethoxy)phenyl]-3-methyl-5-(3-methylphenyl)imidazol-4-one;2-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 158457531 |
| Molecular Formula | C20H25ClF2N6O2 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-amino-5-[4-(difluoromethoxy)phenyl]-3-methyl-5-(3-methylphenyl)imidazol-4-one;2-methylguanidine;hydrochloride |
| SMILES | CN=C(N)N.Cc1cccc(C2(c3ccc(OC(F)F)cc3)N=C(N)N(C)C2=O)c1.Cl |
| InChI | InChI=1S/C18H17F2N3O2.C2H7N3.ClH/c1-11-4-3-5-13(10-11)18(15(24)23(2)17(21)22-18)12-6-8-14(9-7-12)25-16(19)20;1-5-2(3)4;/h3-10,16H,1-2H3,(H2,21,22);1H3,(H4,3,4,5);1H |
| InChIKey | HETIYTWEFKWIJB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|