C23H21F2N3O3 — CID 89001446
2-[3-[3-[2-amino-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl]cyclobutylidene]acetaldehyde (PubChem CID 89001446) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-[3-[3-[2-amino-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl]cyclobutylidene]acetaldehyde.
| Compound Name | 2-[3-[3-[2-amino-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl]cyclobutylidene]acetaldehyde |
|---|---|
| PubChem CID | 89001446 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[3-[3-[2-amino-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl]cyclobutylidene]acetaldehyde |
| SMILES | CN1C(=O)C(c2ccc(OC(F)F)cc2)(c2cccc(C3CC(=CC=O)C3)c2)N=C1N |
| InChI | InChI=1S/C23H21F2N3O3/c1-28-20(30)23(27-22(28)26,17-5-7-19(8-6-17)31-21(24)25)18-4-2-3-15(13-18)16-11-14(12-16)9-10-29/h2-10,13,16,21H,11-12H2,1H3,(H2,26,27)/b14-9- |
| InChIKey | XDNKTQFWYKVZGR-ZROIWOOFSA-N |
| XLogP | 3.32 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|