C19H15Cl3F2N4O3 — CID 25124636
N-[3-[2-amino-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl]-2,2,2-trichloroacetamide (PubChem CID 25124636) has the molecular formula C19H15Cl3F2N4O3 and a molecular weight of 491.71 g/mol. Its IUPAC name is N-[3-[2-amino-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[3-[2-amino-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 25124636 |
| Molecular Formula | C19H15Cl3F2N4O3 |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | N-[3-[2-amino-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl]-2,2,2-trichloroacetamide |
| SMILES | CN1C(=O)C(c2ccc(OC(F)F)cc2)(c2cccc(NC(=O)C(Cl)(Cl)Cl)c2)N=C1N |
| InChI | InChI=1S/C19H15Cl3F2N4O3/c1-28-15(30)18(27-17(28)25,10-5-7-13(8-6-10)31-16(23)24)11-3-2-4-12(9-11)26-14(29)19(20,21)22/h2-9,16H,1H3,(H2,25,27)(H,26,29) |
| InChIKey | MFHIBFRXLBLTSY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|