C22H21FN4O2S — CID 67569613
2-amino-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methyl-5-(2-propanoyl-2,3-dihydrothiophen-4-yl)imidazol-4-one (PubChem CID 67569613) has the molecular formula C22H21FN4O2S and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-amino-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methyl-5-(2-propanoyl-2,3-dihydrothiophen-4-yl)imidazol-4-one.
| Compound Name | 2-amino-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methyl-5-(2-propanoyl-2,3-dihydrothiophen-4-yl)imidazol-4-one |
|---|---|
| PubChem CID | 67569613 |
| Molecular Formula | C22H21FN4O2S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-amino-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methyl-5-(2-propanoyl-2,3-dihydrothiophen-4-yl)imidazol-4-one |
| SMILES | CCC(=O)C1CC(C2(c3cccc(-c4cccnc4F)c3)N=C(N)N(C)C2=O)=CS1 |
| InChI | InChI=1S/C22H21FN4O2S/c1-3-17(28)18-11-15(12-30-18)22(20(29)27(2)21(24)26-22)14-7-4-6-13(10-14)16-8-5-9-25-19(16)23/h4-10,12,18H,3,11H2,1-2H3,(H2,24,26) |
| InChIKey | YZBVJHVMADLQLO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|