C16H15F2N3S — CID 58376896
(4S)-4-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4-methyl-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 58376896) has the molecular formula C16H15F2N3S and a molecular weight of 319.38 g/mol. Its IUPAC name is (4S)-4-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4-methyl-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | (4S)-4-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4-methyl-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 58376896 |
| Molecular Formula | C16H15F2N3S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (4S)-4-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4-methyl-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | C[C@@]1(c2cc(-c3cccnc3F)ccc2F)CCSC(N)=N1 |
| InChI | InChI=1S/C16H15F2N3S/c1-16(6-8-22-15(19)21-16)12-9-10(4-5-13(12)17)11-3-2-7-20-14(11)18/h2-5,7,9H,6,8H2,1H3,(H2,19,21)/t16-/m0/s1 |
| InChIKey | ASQQUHRFLPZNFT-INIZCTEOSA-N |
| XLogP | 3.69 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|