C19H20F3N3OS — CID 143968450
8a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine;fluoromethane (PubChem CID 143968450) has the molecular formula C19H20F3N3OS and a molecular weight of 395.45 g/mol. Its IUPAC name is 8a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine;fluoromethane.
| Compound Name | 8a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine;fluoromethane |
|---|---|
| PubChem CID | 143968450 |
| Molecular Formula | C19H20F3N3OS |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 8a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine;fluoromethane |
| SMILES | CF.NC1=NC2(c3cc(-c4cccnc4F)ccc3F)COCCC2CS1 |
| InChI | InChI=1S/C18H17F2N3OS.CH3F/c19-15-4-3-11(13-2-1-6-22-16(13)20)8-14(15)18-10-24-7-5-12(18)9-25-17(21)23-18;1-2/h1-4,6,8,12H,5,7,9-10H2,(H2,21,23);1H3 |
| InChIKey | QAMCDSWFHZTMPW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|