C20H22FN5O3S — CID 68586164
N-[3-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-ethoxypyrazine-2-carboxamide (PubChem CID 68586164) has the molecular formula C20H22FN5O3S and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[3-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-ethoxypyrazine-2-carboxamide.
| Compound Name | N-[3-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-ethoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 68586164 |
| Molecular Formula | C20H22FN5O3S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[3-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-ethoxypyrazine-2-carboxamide |
| SMILES | CCOc1cnc(C(=O)Nc2ccc(F)c(C34COCCC3CSC(N)=N4)c2)cn1 |
| InChI | InChI=1S/C20H22FN5O3S/c1-2-29-17-9-23-16(8-24-17)18(27)25-13-3-4-15(21)14(7-13)20-11-28-6-5-12(20)10-30-19(22)26-20/h3-4,7-9,12H,2,5-6,10-11H2,1H3,(H2,22,26)(H,25,27) |
| InChIKey | SXYCSXRKJBTRBO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |