C20H20ClFN4O2S — CID 67952281
N-[3-[(4aS,5S,8aS)-2-amino-5-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide (PubChem CID 67952281) has the molecular formula C20H20ClFN4O2S and a molecular weight of 434.92 g/mol. Its IUPAC name is N-[3-[(4aS,5S,8aS)-2-amino-5-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS,5S,8aS)-2-amino-5-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 67952281 |
| Molecular Formula | C20H20ClFN4O2S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[3-[(4aS,5S,8aS)-2-amino-5-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide |
| SMILES | C[C@@H]1COC[C@]2(c3cc(NC(=O)c4ccc(Cl)cn4)ccc3F)N=C(N)SC[C@@H]12 |
| InChI | InChI=1S/C20H20ClFN4O2S/c1-11-8-28-10-20(15(11)9-29-19(23)26-20)14-6-13(3-4-16(14)22)25-18(27)17-5-2-12(21)7-24-17/h2-7,11,15H,8-10H2,1H3,(H2,23,26)(H,25,27)/t11-,15+,20-/m1/s1 |
| InChIKey | OXOOXACJHQYIPO-LQGCGHSZSA-N |
| XLogP | 3.67 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |